C17H26O5 — CID 90344798
(2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid (PubChem CID 90344798) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid.
| Compound Name | (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid |
|---|---|
| PubChem CID | 90344798 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid |
| SMILES | CC1(Cc2ccccc2)OCC(CO)O1.CCCCC(=O)O |
| InChI | InChI=1S/C12H16O3.C5H10O2/c1-12(14-9-11(8-13)15-12)7-10-5-3-2-4-6-10;1-2-3-4-5(6)7/h2-6,11,13H,7-9H2,1H3;2-4H2,1H3,(H,6,7) |
| InChIKey | MWRGFDACOFWMES-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |