(2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid

C17H26O5 — CID 90344798

IUPAC(2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid
SMILESCC1(Cc2ccccc2)OCC(CO)O1.CCCCC(=O)O
InChIInChI=1S/C12H16O3.C5H10O2/c1-12(14-9-11(8-13)15-12)7-10-5-3-2-4-6-10;1-2-3-4-5(6)7/h2-6,11,13H,7-9H2,1H3;2-4H2,1H3,(H,6,7)
InChIKeyMWRGFDACOFWMES-UHFFFAOYSA-N
MW310.39 g/mol
LogP2.61
Rot. Bonds6

About (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid

(2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid (PubChem CID 90344798) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid.

Molecular Properties

Compound Name(2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid
PubChem CID90344798
Molecular FormulaC17H26O5
Molecular Weight310.39 g/mol
Exact Mass310.18
IUPAC Name(2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid
SMILESCC1(Cc2ccccc2)OCC(CO)O1.CCCCC(=O)O
InChIInChI=1S/C12H16O3.C5H10O2/c1-12(14-9-11(8-13)15-12)7-10-5-3-2-4-6-10;1-2-3-4-5(6)7/h2-6,11,13H,7-9H2,1H3;2-4H2,1H3,(H,6,7)
InChIKeyMWRGFDACOFWMES-UHFFFAOYSA-N
XLogP2.61
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.39
LogP ≤ 52.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid?
The IUPAC name of (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid (CID 90344798) is (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid.
What is the SMILES notation for (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid?
The canonical SMILES for (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid is CC1(Cc2ccccc2)OCC(CO)O1.CCCCC(=O)O.
What is the InChIKey of (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid?
The InChIKey is MWRGFDACOFWMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3.C5H10O2/c1-12(14-9-11(8-13)15-12)7-10-5-3-2-4-6-10;1-2-3-4-5(6)7/h2-6,11,13H,7-9H2,1H3;2-4H2,1H3,(H,6,7).
What are the key properties of (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid?
(2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid has a molecular weight of 310.39 g/mol, XLogP of 2.61, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzyl-2-methyl-1,3-dioxolan-4-yl)methanol;pentanoic acid is sourced from PubChem (CID 90344798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).