C21H34O2 — CID 90346937
(5S,8R,9S,10S,13S,14S,17S)-10-ethyl-17-methoxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 90346937) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S,17S)-10-ethyl-17-methoxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,8R,9S,10S,13S,14S,17S)-10-ethyl-17-methoxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 90346937 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S,17S)-10-ethyl-17-methoxy-13-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@]12CCC(=O)C[C@@H]1CC[C@H]1[C@@H]3CC[C@H](OC)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H34O2/c1-4-21-12-9-15(22)13-14(21)5-6-16-17-7-8-19(23-3)20(17,2)11-10-18(16)21/h14,16-19H,4-13H2,1-3H3/t14-,16-,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | YXDLCYYFFBWJGK-NGFSFWIMSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |