C19H14FN7O3S — CID 90347326
N-[5-(3-azidopyrazolo[1,5-a]pyridin-5-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 90347326) has the molecular formula C19H14FN7O3S and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[5-(3-azidopyrazolo[1,5-a]pyridin-5-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[5-(3-azidopyrazolo[1,5-a]pyridin-5-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 90347326 |
| Molecular Formula | C19H14FN7O3S |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[5-(3-azidopyrazolo[1,5-a]pyridin-5-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | COc1ncc(-c2ccn3ncc(N=[N+]=[N-])c3c2)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14FN7O3S/c1-30-19-16(25-31(28,29)15-4-2-14(20)3-5-15)8-13(10-22-19)12-6-7-27-18(9-12)17(11-23-27)24-26-21/h2-11,25H,1H3 |
| InChIKey | XVUHKXQNKHYQOS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|