C17H12FN9O3S — CID 74763628
N-[5-(7-azidoimidazo[1,2-b][1,2,4]triazin-2-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 74763628) has the molecular formula C17H12FN9O3S and a molecular weight of 441.41 g/mol. Its IUPAC name is N-[5-(7-azidoimidazo[1,2-b][1,2,4]triazin-2-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[5-(7-azidoimidazo[1,2-b][1,2,4]triazin-2-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 74763628 |
| Molecular Formula | C17H12FN9O3S |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[5-(7-azidoimidazo[1,2-b][1,2,4]triazin-2-yl)-2-methoxy-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | COc1ncc(-c2cnc3ncc(N=[N+]=[N-])n3n2)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H12FN9O3S/c1-30-16-13(25-31(28,29)12-4-2-11(18)3-5-12)6-10(7-20-16)14-8-21-17-22-9-15(23-26-19)27(17)24-14/h2-9,25H,1H3 |
| InChIKey | DOUOESMRFZWJEV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|