C12H10BrFN2O3S — CID 90030487
N-(5-bromo-2-methoxy-3-pyridinyl)-4-fluorobenzenesulfonamide (PubChem CID 90030487) has the molecular formula C12H10BrFN2O3S and a molecular weight of 361.19 g/mol. Its IUPAC name is N-(5-bromo-2-methoxy-3-pyridinyl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(5-bromo-2-methoxy-3-pyridinyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 90030487 |
| Molecular Formula | C12H10BrFN2O3S |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | N-(5-bromo-2-methoxy-3-pyridinyl)-4-fluorobenzenesulfonamide |
| SMILES | COc1ncc(Br)cc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H10BrFN2O3S/c1-19-12-11(6-8(13)7-15-12)16-20(17,18)10-4-2-9(14)3-5-10/h2-7,16H,1H3 |
| InChIKey | QUFHBWRAYGCSAW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |