C14H14BrFN2O3S — CID 176736990
N-(5-bromo-2-methoxy-3-pyridinyl)-4-ethyl-2-fluorobenzenesulfonamide (PubChem CID 176736990) has the molecular formula C14H14BrFN2O3S and a molecular weight of 389.25 g/mol. Its IUPAC name is N-(5-bromo-2-methoxy-3-pyridinyl)-4-ethyl-2-fluorobenzenesulfonamide.
| Compound Name | N-(5-bromo-2-methoxy-3-pyridinyl)-4-ethyl-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 176736990 |
| Molecular Formula | C14H14BrFN2O3S |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | N-(5-bromo-2-methoxy-3-pyridinyl)-4-ethyl-2-fluorobenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(Br)cnc2OC)c(F)c1 |
| InChI | InChI=1S/C14H14BrFN2O3S/c1-3-9-4-5-13(11(16)6-9)22(19,20)18-12-7-10(15)8-17-14(12)21-2/h4-8,18H,3H2,1-2H3 |
| InChIKey | GABAVKQCYUKNAW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |