C17H19BrF3N3O4S — CID 146211803
N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 146211803) has the molecular formula C17H19BrF3N3O4S and a molecular weight of 498.32 g/mol. Its IUPAC name is N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 146211803 |
| Molecular Formula | C17H19BrF3N3O4S |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CN(C)CCCOc1ncc(Br)cc1NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19BrF3N3O4S/c1-24(2)8-3-9-27-16-15(10-12(18)11-22-16)23-29(25,26)14-6-4-13(5-7-14)28-17(19,20)21/h4-7,10-11,23H,3,8-9H2,1-2H3 |
| InChIKey | LLGPDHJGUAZSJG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|