C17H21BrN4O3S — CID 167553451
N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-isocyanobenzenesulfonamide;molecular hydrogen (PubChem CID 167553451) has the molecular formula C17H21BrN4O3S and a molecular weight of 441.35 g/mol. Its IUPAC name is N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-isocyanobenzenesulfonamide;molecular hydrogen.
| Compound Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-isocyanobenzenesulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 167553451 |
| Molecular Formula | C17H21BrN4O3S |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-isocyanobenzenesulfonamide;molecular hydrogen |
| SMILES | [C-]#[N+]c1cccc(S(=O)(=O)Nc2cc(Br)cnc2OCCCN(C)C)c1.[H][H] |
| InChI | InChI=1S/C17H19BrN4O3S.H2/c1-19-14-6-4-7-15(11-14)26(23,24)21-16-10-13(18)12-20-17(16)25-9-5-8-22(2)3;/h4,6-7,10-12,21H,5,8-9H2,2-3H3;1H |
| InChIKey | CRYDDWZKLPTYBG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|