C12H12BrN3O2S — CID 66800730
N-[5-bromo-2-(methylamino)-3-pyridinyl]benzenesulfonamide (PubChem CID 66800730) has the molecular formula C12H12BrN3O2S and a molecular weight of 342.22 g/mol. Its IUPAC name is N-[5-bromo-2-(methylamino)-3-pyridinyl]benzenesulfonamide.
| Compound Name | N-[5-bromo-2-(methylamino)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66800730 |
| Molecular Formula | C12H12BrN3O2S |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | N-[5-bromo-2-(methylamino)-3-pyridinyl]benzenesulfonamide |
| SMILES | CNc1ncc(Br)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12BrN3O2S/c1-14-12-11(7-9(13)8-15-12)16-19(17,18)10-5-3-2-4-6-10/h2-8,16H,1H3,(H,14,15) |
| InChIKey | AXXLFBQGMKLAGX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |