C7H10BrN3O2S — CID 66820509
N-[5-bromo-2-(methylamino)-3-pyridinyl]methanesulfonamide (PubChem CID 66820509) has the molecular formula C7H10BrN3O2S and a molecular weight of 280.15 g/mol. Its IUPAC name is N-[5-bromo-2-(methylamino)-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[5-bromo-2-(methylamino)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 66820509 |
| Molecular Formula | C7H10BrN3O2S |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | N-[5-bromo-2-(methylamino)-3-pyridinyl]methanesulfonamide |
| SMILES | CNc1ncc(Br)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C7H10BrN3O2S/c1-9-7-6(11-14(2,12)13)3-5(8)4-10-7/h3-4,11H,1-2H3,(H,9,10) |
| InChIKey | WOMAKIKNRPUTPA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |