C9H11BrN2O4S — CID 156693422
N-[5-bromo-2-(oxiran-2-ylmethoxy)-3-pyridinyl]methanesulfonamide (PubChem CID 156693422) has the molecular formula C9H11BrN2O4S and a molecular weight of 323.17 g/mol. Its IUPAC name is N-[5-bromo-2-(oxiran-2-ylmethoxy)-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[5-bromo-2-(oxiran-2-ylmethoxy)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 156693422 |
| Molecular Formula | C9H11BrN2O4S |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | N-[5-bromo-2-(oxiran-2-ylmethoxy)-3-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(Br)cnc1OCC1CO1 |
| InChI | InChI=1S/C9H11BrN2O4S/c1-17(13,14)12-8-2-6(10)3-11-9(8)16-5-7-4-15-7/h2-3,7,12H,4-5H2,1H3 |
| InChIKey | YYJNXPJPHDYEGA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|