C13H19BrFN3O3S — CID 165374036
N-[5-bromo-2-[3-(3-fluoropyrrolidin-1-yl)propoxy]-3-pyridinyl]methanesulfonamide (PubChem CID 165374036) has the molecular formula C13H19BrFN3O3S and a molecular weight of 396.28 g/mol. Its IUPAC name is N-[5-bromo-2-[3-(3-fluoropyrrolidin-1-yl)propoxy]-3-pyridinyl]methanesulfonamide.
| Compound Name | N-[5-bromo-2-[3-(3-fluoropyrrolidin-1-yl)propoxy]-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 165374036 |
| Molecular Formula | C13H19BrFN3O3S |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[5-bromo-2-[3-(3-fluoropyrrolidin-1-yl)propoxy]-3-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(Br)cnc1OCCCN1CCC(F)C1 |
| InChI | InChI=1S/C13H19BrFN3O3S/c1-22(19,20)17-12-7-10(14)8-16-13(12)21-6-2-4-18-5-3-11(15)9-18/h7-8,11,17H,2-6,9H2,1H3 |
| InChIKey | MPJWJRXHHMPUQI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|