C13H20BrN3O4S — CID 170302146
5-bromo-2-[3-(3-methoxypyrrolidin-1-yl)propoxy]-3-(sulfinoamino)pyridine (PubChem CID 170302146) has the molecular formula C13H20BrN3O4S and a molecular weight of 394.29 g/mol. Its IUPAC name is 5-bromo-2-[3-(3-methoxypyrrolidin-1-yl)propoxy]-3-(sulfinoamino)pyridine.
| Compound Name | 5-bromo-2-[3-(3-methoxypyrrolidin-1-yl)propoxy]-3-(sulfinoamino)pyridine |
|---|---|
| PubChem CID | 170302146 |
| Molecular Formula | C13H20BrN3O4S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 5-bromo-2-[3-(3-methoxypyrrolidin-1-yl)propoxy]-3-(sulfinoamino)pyridine |
| SMILES | COC1CCN(CCCOc2ncc(Br)cc2NS(=O)O)C1 |
| InChI | InChI=1S/C13H20BrN3O4S/c1-20-11-3-5-17(9-11)4-2-6-21-13-12(16-22(18)19)7-10(14)8-15-13/h7-8,11,16H,2-6,9H2,1H3,(H,18,19) |
| InChIKey | NTEVWLBZFNFIKS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|