C17H21BrFN3O3S — CID 167561111
N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-fluoro-5-methylbenzenesulfonamide (PubChem CID 167561111) has the molecular formula C17H21BrFN3O3S and a molecular weight of 446.34 g/mol. Its IUPAC name is N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-fluoro-5-methylbenzenesulfonamide.
| Compound Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-fluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 167561111 |
| Molecular Formula | C17H21BrFN3O3S |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-3-fluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(S(=O)(=O)Nc2cc(Br)cnc2OCCCN(C)C)c1 |
| InChI | InChI=1S/C17H21BrFN3O3S/c1-12-7-14(19)10-15(8-12)26(23,24)21-16-9-13(18)11-20-17(16)25-6-4-5-22(2)3/h7-11,21H,4-6H2,1-3H3 |
| InChIKey | DRBCXOYJLQPZEP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|