C17H18BrFN4O3S — CID 165373949
N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-fluoro-3-isocyanobenzenesulfonamide (PubChem CID 165373949) has the molecular formula C17H18BrFN4O3S and a molecular weight of 457.33 g/mol. Its IUPAC name is N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-fluoro-3-isocyanobenzenesulfonamide.
| Compound Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-fluoro-3-isocyanobenzenesulfonamide |
|---|---|
| PubChem CID | 165373949 |
| Molecular Formula | C17H18BrFN4O3S |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | N-[5-bromo-2-[3-(dimethylamino)propoxy]-3-pyridinyl]-4-fluoro-3-isocyanobenzenesulfonamide |
| SMILES | [C-]#[N+]c1cc(S(=O)(=O)Nc2cc(Br)cnc2OCCCN(C)C)ccc1F |
| InChI | InChI=1S/C17H18BrFN4O3S/c1-20-15-10-13(5-6-14(15)19)27(24,25)22-16-9-12(18)11-21-17(16)26-8-4-7-23(2)3/h5-6,9-11,22H,4,7-8H2,2-3H3 |
| InChIKey | ROLIOCGKHPXHHS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|