C16H16N2O4 — CID 90354684
1-(3,4-dimethoxyphenyl)-4-pyrimidin-4-ylbutane-1,4-dione (PubChem CID 90354684) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-pyrimidin-4-ylbutane-1,4-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-pyrimidin-4-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 90354684 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-pyrimidin-4-ylbutane-1,4-dione |
| SMILES | COc1ccc(C(=O)CCC(=O)c2ccncn2)cc1OC |
| InChI | InChI=1S/C16H16N2O4/c1-21-15-6-3-11(9-16(15)22-2)13(19)4-5-14(20)12-7-8-17-10-18-12/h3,6-10H,4-5H2,1-2H3 |
| InChIKey | ADPRXFMXLGPKDN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |