C28H36N8O4S3+2 — CID 90355609
bis[2-[N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl] sulfate (PubChem CID 90355609) has the molecular formula C28H36N8O4S3+2 and a molecular weight of 644.85 g/mol. Its IUPAC name is bis[2-[N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl] sulfate.
| Compound Name | bis[2-[N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl] sulfate |
|---|---|
| PubChem CID | 90355609 |
| Molecular Formula | C28H36N8O4S3+2 |
| Molecular Weight | 644.85 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | bis[2-[N,3-dimethyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]anilino]ethyl] sulfate |
| SMILES | Cc1cc(N(C)CCOS(=O)(=O)OCCN(C)c2ccc(/N=N/c3scc[n+]3C)c(C)c2)ccc1/N=N/c1scc[n+]1C |
| InChI | InChI=1S/C28H36N8O4S3/c1-21-19-23(7-9-25(21)29-31-27-35(5)13-17-41-27)33(3)11-15-39-43(37,38)40-16-12-34(4)24-8-10-26(22(2)20-24)30-32-28-36(6)14-18-42-28/h7-10,13-14,17-20H,11-12,15-16H2,1-6H3/q+2 |
| InChIKey | LUSMBWOZFJCKPI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.85 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|