C8H10Cl3NO5 — CID 90360100
(3aR,6S,7R)-5-(hydroxymethyl)-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole-6,7-diol (PubChem CID 90360100) has the molecular formula C8H10Cl3NO5 and a molecular weight of 306.53 g/mol. Its IUPAC name is (3aR,6S,7R)-5-(hydroxymethyl)-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole-6,7-diol.
| Compound Name | (3aR,6S,7R)-5-(hydroxymethyl)-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole-6,7-diol |
|---|---|
| PubChem CID | 90360100 |
| Molecular Formula | C8H10Cl3NO5 |
| Molecular Weight | 306.53 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | (3aR,6S,7R)-5-(hydroxymethyl)-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole-6,7-diol |
| SMILES | OCC1O[C@@H]2OC(C(Cl)(Cl)Cl)=NC2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H10Cl3NO5/c9-8(10,11)7-12-3-5(15)4(14)2(1-13)16-6(3)17-7/h2-6,13-15H,1H2/t2?,3?,4-,5-,6-/m1/s1 |
| InChIKey | KIPZDKOPMDYVGF-YHMDAOSXSA-N |
| XLogP | -0.41 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.53 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|