C10H14Cl3NO2 — CID 163941558
(3aS,5R,7R)-5,6,7-trimethyl-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole (PubChem CID 163941558) has the molecular formula C10H14Cl3NO2 and a molecular weight of 286.59 g/mol. Its IUPAC name is (3aS,5R,7R)-5,6,7-trimethyl-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole.
| Compound Name | (3aS,5R,7R)-5,6,7-trimethyl-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 163941558 |
| Molecular Formula | C10H14Cl3NO2 |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | (3aS,5R,7R)-5,6,7-trimethyl-2-(trichloromethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole |
| SMILES | CC1[C@@H](C)C2N=C(C(Cl)(Cl)Cl)O[C@@H]2O[C@@H]1C |
| InChI | InChI=1S/C10H14Cl3NO2/c1-4-5(2)7-8(15-6(4)3)16-9(14-7)10(11,12)13/h4-8H,1-3H3/t4?,5-,6-,7?,8+/m1/s1 |
| InChIKey | RRKVAFIIDUXIGC-LYKGQIASSA-N |
| XLogP | 3.17 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|