C10H17NO2 — CID 159785230
(3aS,5R,6S,7S)-2,5,6,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole (PubChem CID 159785230) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (3aS,5R,6S,7S)-2,5,6,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole.
| Compound Name | (3aS,5R,6S,7S)-2,5,6,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 159785230 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (3aS,5R,6S,7S)-2,5,6,7-tetramethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazole |
| SMILES | CC1=NC2[C@H](O1)O[C@H](C)[C@@H](C)[C@@H]2C |
| InChI | InChI=1S/C10H17NO2/c1-5-6(2)9-10(12-7(5)3)13-8(4)11-9/h5-7,9-10H,1-4H3/t5-,6-,7+,9?,10-/m0/s1 |
| InChIKey | NHWBOCARKQSDPA-YVTZJMIZSA-N |
| XLogP | 1.82 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |