C11H14Cl3NO3S — CID 11268017
(1R,2R,6R,7R,8S)-4,4-dimethyl-7-methylsulfanyl-10-(trichloromethyl)-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undec-9-ene (PubChem CID 11268017) has the molecular formula C11H14Cl3NO3S and a molecular weight of 346.66 g/mol. Its IUPAC name is (1R,2R,6R,7R,8S)-4,4-dimethyl-7-methylsulfanyl-10-(trichloromethyl)-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undec-9-ene.
| Compound Name | (1R,2R,6R,7R,8S)-4,4-dimethyl-7-methylsulfanyl-10-(trichloromethyl)-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undec-9-ene |
|---|---|
| PubChem CID | 11268017 |
| Molecular Formula | C11H14Cl3NO3S |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | (1R,2R,6R,7R,8S)-4,4-dimethyl-7-methylsulfanyl-10-(trichloromethyl)-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undec-9-ene |
| SMILES | CS[C@@H]1[C@H]2N=C(C(Cl)(Cl)Cl)O[C@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C11H14Cl3NO3S/c1-10(2)17-6-5-4(8(19-3)7(6)18-10)15-9(16-5)11(12,13)14/h4-8H,1-3H3/t4-,5+,6+,7+,8+/m0/s1 |
| InChIKey | FCQNXXQQLZWITB-SLBCVNJHSA-N |
| XLogP | 2.79 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|