C37H35N11O3S — CID 90364083
(E)-N-[3-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide (PubChem CID 90364083) has the molecular formula C37H35N11O3S and a molecular weight of 713.83 g/mol. Its IUPAC name is (E)-N-[3-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90364083 |
| Molecular Formula | C37H35N11O3S |
| Molecular Weight | 713.83 g/mol |
| Exact Mass | 713.26 |
| IUPAC Name | (E)-N-[3-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc3cc(/C=C(\C#N)C(=O)NCCCn4c(Sc5cc6c(cc5-c5ccn[nH]5)OCO6)nc5c(N)ncnc54)ccc3c2)CC1 |
| InChI | InChI=1S/C37H35N11O3S/c1-46-11-13-47(14-12-46)27-6-5-24-15-23(3-4-25(24)17-27)16-26(20-38)36(49)40-8-2-10-48-35-33(34(39)41-21-42-35)44-37(48)52-32-19-31-30(50-22-51-31)18-28(32)29-7-9-43-45-29/h3-7,9,15-19,21H,2,8,10-14,22H2,1H3,(H,40,49)(H,43,45)(H2,39,41,42)/b26-16+ |
| InChIKey | BBCAXSQUTBQSSV-WGOQTCKBSA-N |
| XLogP | 4.70 |
| TPSA | 176.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|