C21H24NO6P — CID 90364535
[4-[2-(2-oxo-1-phenylpropyl)piperidine-1-carbonyl]phenyl] dihydrogen phosphate (PubChem CID 90364535) has the molecular formula C21H24NO6P and a molecular weight of 417.40 g/mol. Its IUPAC name is [4-[2-(2-oxo-1-phenylpropyl)piperidine-1-carbonyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-(2-oxo-1-phenylpropyl)piperidine-1-carbonyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90364535 |
| Molecular Formula | C21H24NO6P |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [4-[2-(2-oxo-1-phenylpropyl)piperidine-1-carbonyl]phenyl] dihydrogen phosphate |
| SMILES | CC(=O)C(c1ccccc1)C1CCCCN1C(=O)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C21H24NO6P/c1-15(23)20(16-7-3-2-4-8-16)19-9-5-6-14-22(19)21(24)17-10-12-18(13-11-17)28-29(25,26)27/h2-4,7-8,10-13,19-20H,5-6,9,14H2,1H3,(H2,25,26,27) |
| InChIKey | HPQUOQKCGNNJLP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|