C10H16O4 — CID 90365440
(2R,3S,4R,5S,6R)-2-(hydroxymethyl)-4-methyl-6-prop-1-ynyloxane-3,5-diol (PubChem CID 90365440) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-4-methyl-6-prop-1-ynyloxane-3,5-diol.
| Compound Name | (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-4-methyl-6-prop-1-ynyloxane-3,5-diol |
|---|---|
| PubChem CID | 90365440 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-(hydroxymethyl)-4-methyl-6-prop-1-ynyloxane-3,5-diol |
| SMILES | CC#C[C@H]1O[C@H](CO)[C@@H](O)[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C10H16O4/c1-3-4-7-9(12)6(2)10(13)8(5-11)14-7/h6-13H,5H2,1-2H3/t6-,7-,8-,9+,10+/m1/s1 |
| InChIKey | WNIBPSFDNRHDNY-VFCFLDTKSA-N |
| XLogP | -0.87 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|