C15H24O5 — CID 90365470
[(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-dimethyl-6-prop-2-enyloxan-2-yl]methyl acetate (PubChem CID 90365470) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-dimethyl-6-prop-2-enyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-dimethyl-6-prop-2-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90365470 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3-acetyloxy-4,5-dimethyl-6-prop-2-enyloxan-2-yl]methyl acetate |
| SMILES | C=CC[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C15H24O5/c1-6-7-13-9(2)10(3)15(19-12(5)17)14(20-13)8-18-11(4)16/h6,9-10,13-15H,1,7-8H2,2-5H3/t9-,10+,13+,14+,15-/m0/s1 |
| InChIKey | GYSAXDVKKCKKAY-HLXQIYJLSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|