C22H26N4 — CID 90366839
3-[5-[3-[(2,6-dimethylphenyl)methyl]but-3-enyl]-4-ethyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 90366839) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is 3-[5-[3-[(2,6-dimethylphenyl)methyl]but-3-enyl]-4-ethyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[5-[3-[(2,6-dimethylphenyl)methyl]but-3-enyl]-4-ethyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 90366839 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 3-[5-[3-[(2,6-dimethylphenyl)methyl]but-3-enyl]-4-ethyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | C=C(CCc1nnc(-c2cccnc2)n1CC)Cc1c(C)cccc1C |
| InChI | InChI=1S/C22H26N4/c1-5-26-21(24-25-22(26)19-10-7-13-23-15-19)12-11-16(2)14-20-17(3)8-6-9-18(20)4/h6-10,13,15H,2,5,11-12,14H2,1,3-4H3 |
| InChIKey | BCIWKDOLHUKMDX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|