C21H21N5O3 — CID 90369368
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)propanamide (PubChem CID 90369368) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)propanamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)propanamide |
|---|---|
| PubChem CID | 90369368 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)propanamide |
| SMILES | C=CCn1c(CCC(=O)Nc2ccc3c(c2)OCCO3)nnc1-c1cccnc1 |
| InChI | InChI=1S/C21H21N5O3/c1-2-10-26-19(24-25-21(26)15-4-3-9-22-14-15)7-8-20(27)23-16-5-6-17-18(13-16)29-12-11-28-17/h2-6,9,13-14H,1,7-8,10-12H2,(H,23,27) |
| InChIKey | GULOCLHNIZAXMV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|