C12H10ClNO2S — CID 90369311
[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl formate (PubChem CID 90369311) has the molecular formula C12H10ClNO2S and a molecular weight of 267.74 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl formate.
| Compound Name | [2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl formate |
|---|---|
| PubChem CID | 90369311 |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | [2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]methyl formate |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1COC=O |
| InChI | InChI=1S/C12H10ClNO2S/c1-8-11(6-16-7-15)17-12(14-8)9-2-4-10(13)5-3-9/h2-5,7H,6H2,1H3 |
| InChIKey | DLADSAQMBXKAQZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|