C14H12Br2ClNO2S — CID 51355720
propan-2-yl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate (PubChem CID 51355720) has the molecular formula C14H12Br2ClNO2S and a molecular weight of 453.58 g/mol. Its IUPAC name is propan-2-yl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate.
| Compound Name | propan-2-yl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 51355720 |
| Molecular Formula | C14H12Br2ClNO2S |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 450.86 |
| IUPAC Name | propan-2-yl 2-(4-chlorophenyl)-4-(dibromomethyl)-1,3-thiazole-5-carboxylate |
| SMILES | CC(C)OC(=O)c1sc(-c2ccc(Cl)cc2)nc1C(Br)Br |
| InChI | InChI=1S/C14H12Br2ClNO2S/c1-7(2)20-14(19)11-10(12(15)16)18-13(21-11)8-3-5-9(17)6-4-8/h3-7,12H,1-2H3 |
| InChIKey | SYEALZLPKRHQCF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|