C12H16BrNO3 — CID 90369441
tert-butyl (1R,5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylate (PubChem CID 90369441) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is tert-butyl (1R,5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylate.
| Compound Name | tert-butyl (1R,5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylate |
|---|---|
| PubChem CID | 90369441 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | tert-butyl (1R,5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-2-ene-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]2C=CC(Br)[C@@H]1C2 |
| InChI | InChI=1S/C12H16BrNO3/c1-12(2,3)17-11(16)14-9-6-7(10(14)15)4-5-8(9)13/h4-5,7-9H,6H2,1-3H3/t7-,8?,9-/m0/s1 |
| InChIKey | WVMFDUNXBOHDLW-SMOXQLQSSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|