C12H16BrNO3 — CID 123625433
tert-butyl (5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-1-ene-6-carboxylate (PubChem CID 123625433) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is tert-butyl (5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-1-ene-6-carboxylate.
| Compound Name | tert-butyl (5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-1-ene-6-carboxylate |
|---|---|
| PubChem CID | 123625433 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | tert-butyl (5S)-4-bromo-7-oxo-6-azabicyclo[3.2.1]oct-1-ene-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2=CCC(Br)[C@@H]1C2 |
| InChI | InChI=1S/C12H16BrNO3/c1-12(2,3)17-11(16)14-9-6-7(10(14)15)4-5-8(9)13/h4,8-9H,5-6H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | SYQAEUVDIKZOOW-GKAPJAKFSA-N |
| XLogP | 2.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|