C15H25NO3 — CID 46176900
tert-butyl (3E,5S)-3-ethylidene-5-(2-methylpropyl)-2-oxopyrrolidine-1-carboxylate (PubChem CID 46176900) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl (3E,5S)-3-ethylidene-5-(2-methylpropyl)-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3E,5S)-3-ethylidene-5-(2-methylpropyl)-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 46176900 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | tert-butyl (3E,5S)-3-ethylidene-5-(2-methylpropyl)-2-oxopyrrolidine-1-carboxylate |
| SMILES | C/C=C1\C[C@H](CC(C)C)N(C(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C15H25NO3/c1-7-11-9-12(8-10(2)3)16(13(11)17)14(18)19-15(4,5)6/h7,10,12H,8-9H2,1-6H3/b11-7+/t12-/m0/s1 |
| InChIKey | CZWGZDWIABXIPO-VNKGSWCUSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|