C32H42N6O3S — CID 90374426
4-[[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]carbamoylamino]-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 90374426) has the molecular formula C32H42N6O3S and a molecular weight of 590.79 g/mol. Its IUPAC name is 4-[[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]carbamoylamino]-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]carbamoylamino]-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 90374426 |
| Molecular Formula | C32H42N6O3S |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 4-[[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]carbamoylamino]-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CCCCC1=CN(c2ccc(NC(=O)Nc3ccc(C(=O)NC4CCN(C)CC4)cc3)cc2)SC(N2CCOCC2)=C1 |
| InChI | InChI=1S/C32H42N6O3S/c1-3-4-5-24-22-30(37-18-20-41-21-19-37)42-38(23-24)29-12-10-27(11-13-29)35-32(40)34-26-8-6-25(7-9-26)31(39)33-28-14-16-36(2)17-15-28/h6-13,22-23,28H,3-5,14-21H2,1-2H3,(H,33,39)(H2,34,35,40) |
| InChIKey | FEMDGTXUSDOTGV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|