C38H45N5O3S — CID 90374654
1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-3-[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]urea (PubChem CID 90374654) has the molecular formula C38H45N5O3S and a molecular weight of 651.88 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-3-[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]urea.
| Compound Name | 1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-3-[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 90374654 |
| Molecular Formula | C38H45N5O3S |
| Molecular Weight | 651.88 g/mol |
| Exact Mass | 651.32 |
| IUPAC Name | 1-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-3-[4-(4-butyl-6-morpholin-4-ylthiazin-2-yl)phenyl]urea |
| SMILES | CCCCC1=CN(c2ccc(NC(=O)Nc3ccc(C(=O)N4CCC(Cc5ccccc5)CC4)cc3)cc2)SC(N2CCOCC2)=C1 |
| InChI | InChI=1S/C38H45N5O3S/c1-2-3-7-31-27-36(41-22-24-46-25-23-41)47-43(28-31)35-16-14-34(15-17-35)40-38(45)39-33-12-10-32(11-13-33)37(44)42-20-18-30(19-21-42)26-29-8-5-4-6-9-29/h4-6,8-17,27-28,30H,2-3,7,18-26H2,1H3,(H2,39,40,45) |
| InChIKey | ZIEKUYXGHIMDOO-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.88 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|