C33H43N7O4S — CID 90374588
1-[4-(3,3-dimethylpiperazine-1-carbonyl)phenyl]-3-[4-[4-(2-methylmorpholin-4-yl)-6-morpholin-4-ylthiazin-2-yl]phenyl]urea (PubChem CID 90374588) has the molecular formula C33H43N7O4S and a molecular weight of 633.82 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylpiperazine-1-carbonyl)phenyl]-3-[4-[4-(2-methylmorpholin-4-yl)-6-morpholin-4-ylthiazin-2-yl]phenyl]urea.
| Compound Name | 1-[4-(3,3-dimethylpiperazine-1-carbonyl)phenyl]-3-[4-[4-(2-methylmorpholin-4-yl)-6-morpholin-4-ylthiazin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 90374588 |
| Molecular Formula | C33H43N7O4S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | 1-[4-(3,3-dimethylpiperazine-1-carbonyl)phenyl]-3-[4-[4-(2-methylmorpholin-4-yl)-6-morpholin-4-ylthiazin-2-yl]phenyl]urea |
| SMILES | CC1CN(C2=CN(c3ccc(NC(=O)Nc4ccc(C(=O)N5CCNC(C)(C)C5)cc4)cc3)SC(N3CCOCC3)=C2)CCO1 |
| InChI | InChI=1S/C33H43N7O4S/c1-24-21-38(16-19-44-24)29-20-30(37-14-17-43-18-15-37)45-40(22-29)28-10-8-27(9-11-28)36-32(42)35-26-6-4-25(5-7-26)31(41)39-13-12-34-33(2,3)23-39/h4-11,20,22,24,34H,12-19,21,23H2,1-3H3,(H2,35,36,42) |
| InChIKey | ARCCSGWVQIEHBO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|