C35H49N7O2S — CID 90374603
1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-[4-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]-6-(3-methylmorpholin-4-yl)thiazin-2-yl]phenyl]urea (PubChem CID 90374603) has the molecular formula C35H49N7O2S and a molecular weight of 631.89 g/mol. Its IUPAC name is 1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-[4-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]-6-(3-methylmorpholin-4-yl)thiazin-2-yl]phenyl]urea.
| Compound Name | 1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-[4-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]-6-(3-methylmorpholin-4-yl)thiazin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 90374603 |
| Molecular Formula | C35H49N7O2S |
| Molecular Weight | 631.89 g/mol |
| Exact Mass | 631.37 |
| IUPAC Name | 1-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-3-[4-[4-[(2R,5S)-2,5-dimethylpyrrolidin-1-yl]-6-(3-methylmorpholin-4-yl)thiazin-2-yl]phenyl]urea |
| SMILES | CC1COCCN1C1=CC(N2[C@H](C)CC[C@@H]2C)=CN(c2ccc(NC(=O)Nc3ccc(N4CCC(N(C)C)CC4)cc3)cc2)S1 |
| InChI | InChI=1S/C35H49N7O2S/c1-25-6-7-26(2)42(25)33-22-34(40-20-21-44-24-27(40)3)45-41(23-33)32-14-10-29(11-15-32)37-35(43)36-28-8-12-31(13-9-28)39-18-16-30(17-19-39)38(4)5/h8-15,22-23,25-27,30H,6-7,16-21,24H2,1-5H3,(H2,36,37,43)/t25-,26+,27? |
| InChIKey | LBOOOXHQTMZYAX-ZVBBVAIHSA-N |
| XLogP | 6.61 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.89 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|