C17H23N5O — CID 90374932
N-(2-cyanoethyl)-2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-N-ethylacetamide (PubChem CID 90374932) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-N-ethylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 90374932 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-N-ethylacetamide |
| SMILES | CCN(CCC#N)C(=O)CNCc1cc(/C=N/C2CC2)ccn1 |
| InChI | InChI=1S/C17H23N5O/c1-2-22(9-3-7-18)17(23)13-19-12-16-10-14(6-8-20-16)11-21-15-4-5-15/h6,8,10-11,15,19H,2-5,9,12-13H2,1H3/b21-11+ |
| InChIKey | GWEFYAUJUFHGER-SRZZPIQSSA-N |
| XLogP | 1.51 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|