C14H7Cl2N3O3S — CID 9037548
5-[(Z)-1-chloro-2-(4-chloro-3-nitrophenyl)ethenyl]-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 9037548) has the molecular formula C14H7Cl2N3O3S and a molecular weight of 368.20 g/mol. Its IUPAC name is 5-[(Z)-1-chloro-2-(4-chloro-3-nitrophenyl)ethenyl]-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(Z)-1-chloro-2-(4-chloro-3-nitrophenyl)ethenyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 9037548 |
| Molecular Formula | C14H7Cl2N3O3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 5-[(Z)-1-chloro-2-(4-chloro-3-nitrophenyl)ethenyl]-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(/C=C(\Cl)c2nc(-c3cccs3)no2)ccc1Cl |
| InChI | InChI=1S/C14H7Cl2N3O3S/c15-9-4-3-8(7-11(9)19(20)21)6-10(16)14-17-13(18-22-14)12-2-1-5-23-12/h1-7H/b10-6- |
| InChIKey | SARONVRYCGCJCW-POHAHGRESA-N |
| XLogP | 5.10 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|