C17H25N5O — CID 90375995
2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 90375995) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 90375995 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 2-[[4-(cyclopropyliminomethyl)-2-pyridinyl]methylamino]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CNCc2cc(/C=N/C3CC3)ccn2)CC1 |
| InChI | InChI=1S/C17H25N5O/c1-21-6-8-22(9-7-21)17(23)13-18-12-16-10-14(4-5-19-16)11-20-15-2-3-15/h4-5,10-11,15,18H,2-3,6-9,12-13H2,1H3/b20-11+ |
| InChIKey | PPXPZPJQEAJHRN-RGVLZGJSSA-N |
| XLogP | 0.53 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|