C25H23N7O — CID 90378274
2-(azidomethyl)-4-(2-cyanophenyl)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide (PubChem CID 90378274) has the molecular formula C25H23N7O and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-(azidomethyl)-4-(2-cyanophenyl)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide.
| Compound Name | 2-(azidomethyl)-4-(2-cyanophenyl)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide |
|---|---|
| PubChem CID | 90378274 |
| Molecular Formula | C25H23N7O |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-(azidomethyl)-4-(2-cyanophenyl)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)benzamide |
| SMILES | N#Cc1ccccc1-c1ccc(C(=O)N(C2CC2)C2CCc3[nH]ncc3C2)c(CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C25H23N7O/c26-13-17-3-1-2-4-22(17)16-5-9-23(18(11-16)14-29-31-27)25(33)32(20-6-7-20)21-8-10-24-19(12-21)15-28-30-24/h1-5,9,11,15,20-21H,6-8,10,12,14H2,(H,28,30) |
| InChIKey | ZLFLGPMTVBSGBL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|