C23H26N4O — CID 90381983
N-cyclopropyl-2,5-dimethyl-1-phenyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrole-3-carboxamide (PubChem CID 90381983) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is N-cyclopropyl-2,5-dimethyl-1-phenyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrole-3-carboxamide.
| Compound Name | N-cyclopropyl-2,5-dimethyl-1-phenyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90381983 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-cyclopropyl-2,5-dimethyl-1-phenyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C2CC2)C2CCc3[nH]ncc3C2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H26N4O/c1-15-12-21(16(2)26(15)18-6-4-3-5-7-18)23(28)27(19-8-9-19)20-10-11-22-17(13-20)14-24-25-22/h3-7,12,14,19-20H,8-11,13H2,1-2H3,(H,24,25) |
| InChIKey | BLODVLONMLPMLQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|