C22H22N6O2 — CID 90378103
6-(azidomethoxy)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)naphthalene-2-carboxamide (PubChem CID 90378103) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 6-(azidomethoxy)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)naphthalene-2-carboxamide.
| Compound Name | 6-(azidomethoxy)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 90378103 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 6-(azidomethoxy)-N-cyclopropyl-N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)naphthalene-2-carboxamide |
| SMILES | [N-]=[N+]=NCOc1ccc2cc(C(=O)N(C3CC3)C3CCc4[nH]ncc4C3)ccc2c1 |
| InChI | InChI=1S/C22H22N6O2/c23-27-25-13-30-20-7-3-14-9-16(2-1-15(14)11-20)22(29)28(18-4-5-18)19-6-8-21-17(10-19)12-24-26-21/h1-3,7,9,11-12,18-19H,4-6,8,10,13H2,(H,24,26) |
| InChIKey | UIQMTOORELBOGR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|