C29H32N6O3 — CID 90378094
(1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-(3-methyl-4-phenylbenzoyl)amino]-4,5,6,7-tetrahydroindazole-2-carboxylate (PubChem CID 90378094) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is (1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-(3-methyl-4-phenylbenzoyl)amino]-4,5,6,7-tetrahydroindazole-2-carboxylate.
| Compound Name | (1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-(3-methyl-4-phenylbenzoyl)amino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
|---|---|
| PubChem CID | 90378094 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-(3-methyl-4-phenylbenzoyl)amino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
| SMILES | Cc1cc(C(=O)N(C2CC2)C2CCc3nn(C(=O)OC(C)(C)CN=[N+]=[N-])cc3C2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C29H32N6O3/c1-19-15-21(9-13-25(19)20-7-5-4-6-8-20)27(36)35(23-10-11-23)24-12-14-26-22(16-24)17-34(32-26)28(37)38-29(2,3)18-31-33-30/h4-9,13,15,17,23-24H,10-12,14,16,18H2,1-3H3 |
| InChIKey | HCOIFFOXWUDHOH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|