C25H28N10O3 — CID 129300731
(1-azido-2-methylpropan-2-yl) 5-[[1-(azidomethyl)indole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate (PubChem CID 129300731) has the molecular formula C25H28N10O3 and a molecular weight of 516.57 g/mol. Its IUPAC name is (1-azido-2-methylpropan-2-yl) 5-[[1-(azidomethyl)indole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate.
| Compound Name | (1-azido-2-methylpropan-2-yl) 5-[[1-(azidomethyl)indole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
|---|---|
| PubChem CID | 129300731 |
| Molecular Formula | C25H28N10O3 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (1-azido-2-methylpropan-2-yl) 5-[[1-(azidomethyl)indole-4-carbonyl]-cyclopropylamino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
| SMILES | CC(C)(CN=[N+]=[N-])OC(=O)n1cc2c(n1)CCC(N(C(=O)c1cccc3c1ccn3CN=[N+]=[N-])C1CC1)C2 |
| InChI | InChI=1S/C25H28N10O3/c1-25(2,14-28-31-26)38-24(37)34-13-16-12-18(8-9-21(16)30-34)35(17-6-7-17)23(36)20-4-3-5-22-19(20)10-11-33(22)15-29-32-27/h3-5,10-11,13,17-18H,6-9,12,14-15H2,1-2H3 |
| InChIKey | CPUSYYPFPZGFQO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 166.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|