C30H32N6O4 — CID 90378165
(1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-[4-(2,3-dihydro-1-benzofuran-5-yl)benzoyl]amino]-4,5,6,7-tetrahydroindazole-2-carboxylate (PubChem CID 90378165) has the molecular formula C30H32N6O4 and a molecular weight of 540.62 g/mol. Its IUPAC name is (1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-[4-(2,3-dihydro-1-benzofuran-5-yl)benzoyl]amino]-4,5,6,7-tetrahydroindazole-2-carboxylate.
| Compound Name | (1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-[4-(2,3-dihydro-1-benzofuran-5-yl)benzoyl]amino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
|---|---|
| PubChem CID | 90378165 |
| Molecular Formula | C30H32N6O4 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (1-azido-2-methylpropan-2-yl) 5-[cyclopropyl-[4-(2,3-dihydro-1-benzofuran-5-yl)benzoyl]amino]-4,5,6,7-tetrahydroindazole-2-carboxylate |
| SMILES | CC(C)(CN=[N+]=[N-])OC(=O)n1cc2c(n1)CCC(N(C(=O)c1ccc(-c3ccc4c(c3)CCO4)cc1)C1CC1)C2 |
| InChI | InChI=1S/C30H32N6O4/c1-30(2,18-32-34-31)40-29(38)35-17-23-16-25(10-11-26(23)33-35)36(24-8-9-24)28(37)20-5-3-19(4-6-20)21-7-12-27-22(15-21)13-14-39-27/h3-7,12,15,17,24-25H,8-11,13-14,16,18H2,1-2H3 |
| InChIKey | AVPZWTKKMNTGSE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|