C25H24ClN6O5P — CID 90378628
[4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]phosphonic acid (PubChem CID 90378628) has the molecular formula C25H24ClN6O5P and a molecular weight of 554.93 g/mol. Its IUPAC name is [4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]phosphonic acid.
| Compound Name | [4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 90378628 |
| Molecular Formula | C25H24ClN6O5P |
| Molecular Weight | 554.93 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | [4-[[(2S)-2-[[(E)-3-[5-chloro-2-(2,3-dihydrotetrazol-1-yl)phenyl]prop-2-enoyl]amino]-3-phenylpropanoyl]amino]phenyl]phosphonic acid |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1N1C=NNN1)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(P(=O)(O)O)cc1 |
| InChI | InChI=1S/C25H24ClN6O5P/c26-19-7-12-23(32-16-27-30-31-32)18(15-19)6-13-24(33)29-22(14-17-4-2-1-3-5-17)25(34)28-20-8-10-21(11-9-20)38(35,36)37/h1-13,15-16,22,30-31H,14H2,(H,28,34)(H,29,33)(H2,35,36,37)/b13-6+/t22-/m0/s1 |
| InChIKey | NRMAJSSRHUBMDH-YUWCZGPHSA-N |
| XLogP | 2.29 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.93 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|