C15H24F6O4 — CID 90379756
butyl 2-methyl-2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]butanoate (PubChem CID 90379756) has the molecular formula C15H24F6O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is butyl 2-methyl-2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]butanoate.
| Compound Name | butyl 2-methyl-2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]butanoate |
|---|---|
| PubChem CID | 90379756 |
| Molecular Formula | C15H24F6O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | butyl 2-methyl-2-[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]methyl]butanoate |
| SMILES | CCCCOC(=O)C(C)(CC)COCCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H24F6O4/c1-4-6-8-25-11(22)12(3,5-2)10-24-9-7-13(23,14(16,17)18)15(19,20)21/h23H,4-10H2,1-3H3 |
| InChIKey | FZBMHJLQHFBAHI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|