About methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate
methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate (PubChem CID 130433106) has the molecular formula C12H21F3O4
and a molecular weight of 286.29 g/mol. Its IUPAC name is methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate.
Molecular Properties
| Compound Name | methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate |
| PubChem CID | 130433106 |
| Molecular Formula | C12H21F3O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate |
| SMILES | CCC(C)(COCCC(C)(O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C12H21F3O4/c1-5-10(2,9(16)18-4)8-19-7-6-11(3,17)12(13,14)15/h17H,5-8H2,1-4H3 |
| InChIKey | ODFUQAHTSQALHN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate?
The IUPAC name of methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate (CID 130433106) is methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate.
What is the SMILES notation for methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate?
The canonical SMILES for methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate is CCC(C)(COCCC(C)(O)C(F)(F)F)C(=O)OC.
What is the InChIKey of methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate?
The InChIKey is ODFUQAHTSQALHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3O4/c1-5-10(2,9(16)18-4)8-19-7-6-11(3,17)12(13,14)15/h17H,5-8H2,1-4H3.
What are the key properties of methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate?
methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate has a molecular weight of 286.29 g/mol, XLogP of 2.30, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate is sourced from PubChem (CID 130433106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).