C12H21F3O4 — CID 130433106
methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate (PubChem CID 130433106) has the molecular formula C12H21F3O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate.
| Compound Name | methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate |
|---|---|
| PubChem CID | 130433106 |
| Molecular Formula | C12H21F3O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methyl 2-methyl-2-[(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)methyl]butanoate |
| SMILES | CCC(C)(COCCC(C)(O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C12H21F3O4/c1-5-10(2,9(16)18-4)8-19-7-6-11(3,17)12(13,14)15/h17H,5-8H2,1-4H3 |
| InChIKey | ODFUQAHTSQALHN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|