C34H28N2O — CID 90379869
5-(9,9-dimethyl-10-phenyl-5,6-dihydroacridin-2-yl)phenanthridin-6-one (PubChem CID 90379869) has the molecular formula C34H28N2O and a molecular weight of 480.61 g/mol. Its IUPAC name is 5-(9,9-dimethyl-10-phenyl-5,6-dihydroacridin-2-yl)phenanthridin-6-one.
| Compound Name | 5-(9,9-dimethyl-10-phenyl-5,6-dihydroacridin-2-yl)phenanthridin-6-one |
|---|---|
| PubChem CID | 90379869 |
| Molecular Formula | C34H28N2O |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 5-(9,9-dimethyl-10-phenyl-5,6-dihydroacridin-2-yl)phenanthridin-6-one |
| SMILES | CC1(C)C2=C(CCC=C2)N(c2ccccc2)c2ccc(-n3c(=O)c4ccccc4c4ccccc43)cc21 |
| InChI | InChI=1S/C34H28N2O/c1-34(2)28-17-9-11-19-31(28)35(23-12-4-3-5-13-23)32-21-20-24(22-29(32)34)36-30-18-10-8-15-26(30)25-14-6-7-16-27(25)33(36)37/h3-10,12-18,20-22H,11,19H2,1-2H3 |
| InChIKey | WVYLNNIOYPJKMT-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|