C23H20F2N2O4 — CID 90385214
ethyl (E)-2-cyano-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate (PubChem CID 90385214) has the molecular formula C23H20F2N2O4 and a molecular weight of 426.42 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 90385214 |
| Molecular Formula | C23H20F2N2O4 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(C(=O)C(C)(C)NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C23H20F2N2O4/c1-4-31-22(30)16(13-26)12-14-8-10-15(11-9-14)20(28)23(2,3)27-21(29)19-17(24)6-5-7-18(19)25/h5-12H,4H2,1-3H3,(H,27,29)/b16-12+ |
| InChIKey | FZHFKBIGTVQJNC-FOWTUZBSSA-N |
| XLogP | 3.83 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|